EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N.HCl |
| Net Charge | 0 |
| Average Mass | 317.904 |
| Monoisotopic Mass | 317.19103 |
| SMILES | CCN(CCCc1ccccc1)CCCc1ccccc1.Cl |
| InChI | InChI=1S/C20H27N.ClH/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;/h3-8,11-14H,2,9-10,15-18H2,1H3;1H |
| InChIKey | ZKRKHXXSBDSIKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine hydrochloride (CHEBI:53786) has part alverine(1+) (CHEBI:64320) |
| alverine hydrochloride (CHEBI:53786) has role antispasmodic drug (CHEBI:53784) |
| alverine hydrochloride (CHEBI:53786) is a hydrochloride (CHEBI:36807) |
| alverine hydrochloride (CHEBI:53786) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine hydrochloride |
| Synonym | Source |
|---|---|
| Ethylbis(3-phenylpropyl)ammonium chloride | ChEBI |