EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 473.566 |
| Monoisotopic Mass | 473.24135 |
| SMILES | CCN(CCCc1ccccc1)CCCc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RYHCACJBKCOBTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine citrate (CHEBI:53785) has part alverine(1+) (CHEBI:64320) |
| alverine citrate (CHEBI:53785) has role antispasmodic drug (CHEBI:53784) |
| alverine citrate (CHEBI:53785) has role cholinergic antagonist (CHEBI:48873) |
| alverine citrate (CHEBI:53785) is a citrate salt (CHEBI:50744) |
| alverine citrate (CHEBI:53785) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonym | Source |
|---|---|
| N-Ethyl-3,3'-diphenyldipropylamine citrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101838205 | Patent |
| D02877 | KEGG DRUG |
| DB01616 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3851428 | Reaxys |
| CAS:5560-59-8 | KEGG DRUG |
| CAS:5560-59-8 | ChemIDplus |
| Citations |
|---|