EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 473.566 |
| Monoisotopic Mass | 473.24135 |
| SMILES | CCN(CCCc1ccccc1)CCCc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RYHCACJBKCOBTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine citrate (CHEBI:53785) has part alverine(1+) (CHEBI:64320) |
| alverine citrate (CHEBI:53785) has role antispasmodic drug (CHEBI:53784) |
| alverine citrate (CHEBI:53785) has role cholinergic antagonist (CHEBI:48873) |
| alverine citrate (CHEBI:53785) is a citrate salt (CHEBI:50744) |
| alverine citrate (CHEBI:53785) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonym | Source |
|---|---|
| N-Ethyl-3,3'-diphenyldipropylamine citrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101838205 | Patent |
| D02877 | KEGG DRUG |
| DB01616 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3851428 | Reaxys |
| CAS:5560-59-8 | KEGG DRUG |
| CAS:5560-59-8 | ChemIDplus |
| Citations |
|---|