EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 473.566 |
| Monoisotopic Mass | 473.24135 |
| SMILES | CCN(CCCc1ccccc1)CCCc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RYHCACJBKCOBTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine citrate (CHEBI:53785) has part alverine(1+) (CHEBI:64320) |
| alverine citrate (CHEBI:53785) has role antihypertensive agent (CHEBI:35674) |
| alverine citrate (CHEBI:53785) has role antispasmodic drug (CHEBI:53784) |
| alverine citrate (CHEBI:53785) has role cholinergic antagonist (CHEBI:48873) |
| alverine citrate (CHEBI:53785) is a citrate salt (CHEBI:50744) |
| alverine citrate (CHEBI:53785) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Antispasmin | ChEMBL |
| Calmabel | ChEMBL |
| Gamatran citrate | ChEMBL |
| N-Ethyl-3,3'-diphenyldipropylamine citrate | ChemIDplus |
| NSC-35459 | ChEMBL |
| Phenpropamine citrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Audmonal | ChEMBL |
| Gielism | ChEMBL |
| Relaxyl | ChEMBL |
| Spasmonal | ChEMBL |
| Spasmonal fte | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| CN101838205 | Patent |
| D02877 | KEGG DRUG |
| DB01616 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3851428 | Reaxys |
| CAS:5560-59-8 | KEGG DRUG |
| CAS:5560-59-8 | ChemIDplus |
| Citations |
|---|