EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21FNO3 |
| Net Charge | +1 |
| Average Mass | 330.379 |
| Monoisotopic Mass | 330.15000 |
| SMILES | [H][C@@]1(c2ccc(F)cc2)CC[NH2+]C[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/p+1/t14-,17-/m0/s1 |
| InChIKey | AHOUBRCZNHFOSL-YOEHRIQHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetinium(1+) (CHEBI:64197) is a ammonium ion derivative (CHEBI:35274) |
| paroxetinium(1+) (CHEBI:64197) is a organic cation (CHEBI:25697) |
| paroxetinium(1+) (CHEBI:64197) is conjugate acid of paroxetine (CHEBI:7936) |
| Incoming Relation(s) |
| paroxetine hydrochloride (CHEBI:7944) has part paroxetinium(1+) (CHEBI:64197) |
| paroxetine maleate (CHEBI:64194) has part paroxetinium(1+) (CHEBI:64197) |
| paroxetine (CHEBI:7936) is conjugate base of paroxetinium(1+) (CHEBI:64197) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidinium |
| Synonyms | Source |
|---|---|
| paroxetine(1+) | ChEBI |
| paroxetine cation | ChEBI |
| paroxetinium cation | ChEBI |