EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FNO3 |
| Net Charge | 0 |
| Average Mass | 329.371 |
| Monoisotopic Mass | 329.14272 |
| SMILES | [H][C@@]1(c2ccc(F)cc2)CCNC[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17-/m0/s1 |
| InChIKey | AHOUBRCZNHFOSL-YOEHRIQHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetine (CHEBI:7936) has role antidepressant (CHEBI:35469) |
| paroxetine (CHEBI:7936) has role anxiolytic drug (CHEBI:35474) |
| paroxetine (CHEBI:7936) has role hepatotoxic agent (CHEBI:50908) |
| paroxetine (CHEBI:7936) has role P450 inhibitor (CHEBI:50183) |
| paroxetine (CHEBI:7936) has role serotonin uptake inhibitor (CHEBI:50949) |
| paroxetine (CHEBI:7936) is a aromatic ether (CHEBI:35618) |
| paroxetine (CHEBI:7936) is a benzodioxoles (CHEBI:38298) |
| paroxetine (CHEBI:7936) is a monofluorobenzenes (CHEBI:83575) |
| paroxetine (CHEBI:7936) is a piperidines (CHEBI:26151) |
| paroxetine (CHEBI:7936) is conjugate base of paroxetinium(1+) (CHEBI:64197) |
| Incoming Relation(s) |
| N-methylparoxetine (CHEBI:94536) has functional parent paroxetine (CHEBI:7936) |
| 6-nitroparoxetine (CHEBI:233619) has functional parent paroxetine (CHEBI:7936) |
| paroxetinium(1+) (CHEBI:64197) is conjugate acid of paroxetine (CHEBI:7936) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine |
| INNs | Source |
|---|---|
| paroxetina | DrugBank |
| paroxetinum | DrugBank |
| Synonyms | Source |
|---|---|
| (−)-(3S,4R)-4-(p-fluorophenyl)-3-((3,4-(methylenedioxy)phenoxy)methyl)piperidine | ChemIDplus |
| (3S-trans)-3-((1,3-benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine | ChemIDplus |
| Paroxetine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7467879 | Reaxys |
| CAS:61869-08-7 | KEGG COMPOUND |
| CAS:61869-08-7 | ChemIDplus |
| Citations |
|---|