EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FNO3 |
| Net Charge | 0 |
| Average Mass | 329.371 |
| Monoisotopic Mass | 329.14272 |
| SMILES | [H][C@@]1(c2ccc(F)cc2)CCNC[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17-/m0/s1 |
| InChIKey | AHOUBRCZNHFOSL-YOEHRIQHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetine (CHEBI:7936) has role antidepressant (CHEBI:35469) |
| paroxetine (CHEBI:7936) has role anxiolytic drug (CHEBI:35474) |
| paroxetine (CHEBI:7936) has role hepatotoxic agent (CHEBI:50908) |
| paroxetine (CHEBI:7936) has role P450 inhibitor (CHEBI:50183) |
| paroxetine (CHEBI:7936) has role serotonin uptake inhibitor (CHEBI:50949) |
| paroxetine (CHEBI:7936) is a aromatic ether (CHEBI:35618) |
| paroxetine (CHEBI:7936) is a benzodioxoles (CHEBI:38298) |
| paroxetine (CHEBI:7936) is a monofluorobenzenes (CHEBI:83575) |
| paroxetine (CHEBI:7936) is a piperidines (CHEBI:26151) |
| paroxetine (CHEBI:7936) is conjugate base of paroxetinium(1+) (CHEBI:64197) |
| Incoming Relation(s) |
| N-methylparoxetine (CHEBI:94536) has functional parent paroxetine (CHEBI:7936) |
| 6-nitroparoxetine (CHEBI:233619) has functional parent paroxetine (CHEBI:7936) |
| paroxetinium(1+) (CHEBI:64197) is conjugate acid of paroxetine (CHEBI:7936) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine |
| INNs | Source |
|---|---|
| paroxetina | DrugBank |
| paroxetinum | DrugBank |
| Synonyms | Source |
|---|---|
| (−)-(3S,4R)-4-(p-fluorophenyl)-3-((3,4-(methylenedioxy)phenoxy)methyl)piperidine | ChemIDplus |
| (3S-trans)-3-((1,3-benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine | ChemIDplus |
| Paroxetine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7467879 | Reaxys |
| CAS:61869-08-7 | KEGG COMPOUND |
| CAS:61869-08-7 | ChemIDplus |
| Citations |
|---|