EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FNO3.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 445.443 |
| Monoisotopic Mass | 445.15368 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]1(c2ccc(F)cc2)CCNC[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3.C4H4O4/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18;5-3(6)1-2-4(7)8/h1-6,9,14,17,21H,7-8,10-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,17-;/m0./s1 |
| InChIKey | AEIUZSKXSWGSRU-QXGDPHCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetine maleate (CHEBI:64194) has part paroxetinium(1+) (CHEBI:64197) |
| paroxetine maleate (CHEBI:64194) has role antidepressant (CHEBI:35469) |
| paroxetine maleate (CHEBI:64194) has role anxiolytic drug (CHEBI:35474) |
| paroxetine maleate (CHEBI:64194) has role hepatotoxic agent (CHEBI:50908) |
| paroxetine maleate (CHEBI:64194) has role P450 inhibitor (CHEBI:50183) |
| paroxetine maleate (CHEBI:64194) has role serotonin uptake inhibitor (CHEBI:50949) |
| paroxetine maleate (CHEBI:64194) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine maleate | ChEBI |
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidinium (2Z)-3-carboxyacrylate | IUPAC |
| (-)-alpha-4-(4-Fluorophenyl)-3-(1,3-benzdioxolyl-(3))-oxymethyl piperidine maleate | ChemIDplus |
| trans-(-)-3-((1,3-Benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine maleate | ChemIDplus |