EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FNO3.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 445.443 |
| Monoisotopic Mass | 445.15368 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@@]1(c2ccc(F)cc2)CCNC[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3.C4H4O4/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18;5-3(6)1-2-4(7)8/h1-6,9,14,17,21H,7-8,10-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,17-;/m0./s1 |
| InChIKey | AEIUZSKXSWGSRU-QXGDPHCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetine maleate (CHEBI:64194) has part paroxetinium(1+) (CHEBI:64197) |
| paroxetine maleate (CHEBI:64194) has role antidepressant (CHEBI:35469) |
| paroxetine maleate (CHEBI:64194) has role anxiolytic drug (CHEBI:35474) |
| paroxetine maleate (CHEBI:64194) has role hepatotoxic agent (CHEBI:50908) |
| paroxetine maleate (CHEBI:64194) has role P450 inhibitor (CHEBI:50183) |
| paroxetine maleate (CHEBI:64194) has role serotonin uptake inhibitor (CHEBI:50949) |
| paroxetine maleate (CHEBI:64194) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| trans-(-)-3-((1,3-Benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine maleate | ChemIDplus |
| (-)-alpha-4-(4-Fluorophenyl)-3-(1,3-benzdioxolyl-(3))-oxymethyl piperidine maleate | ChemIDplus |
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine maleate | ChEBI |
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidinium (2Z)-3-carboxyacrylate | IUPAC |