EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FNO3.HCl |
| Net Charge | 0 |
| Average Mass | 365.832 |
| Monoisotopic Mass | 365.11940 |
| SMILES | [H]Cl.[H][C@@]1(c2ccc(F)cc2)CCNC[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20FNO3.ClH/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18;/h1-6,9,14,17,21H,7-8,10-12H2;1H/t14-,17-;/m0./s1 |
| InChIKey | GELRVIPPMNMYGS-RVXRQPKJSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paroxetine hydrochloride (CHEBI:7944) has part paroxetinium(1+) (CHEBI:64197) |
| paroxetine hydrochloride (CHEBI:7944) has role antidepressant (CHEBI:35469) |
| paroxetine hydrochloride (CHEBI:7944) has role anxiolytic drug (CHEBI:35474) |
| paroxetine hydrochloride (CHEBI:7944) has role hepatotoxic agent (CHEBI:50908) |
| paroxetine hydrochloride (CHEBI:7944) has role P450 inhibitor (CHEBI:50183) |
| paroxetine hydrochloride (CHEBI:7944) has role serotonin uptake inhibitor (CHEBI:50949) |
| paroxetine hydrochloride (CHEBI:7944) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine hydrochloride |
| Synonyms | Source |
|---|---|
| paroxetine HCl | ChemIDplus |
| paroxetine hydrochloride anhydrous | DrugBank |
| Brand Names | Source |
|---|---|
| Aropax | ChEBI |
| Paroxat | ChemIDplus |
| Paxil | KEGG DRUG |
| Seroxat | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05374 | KEGG DRUG |
| DBSALT000132 | DrugBank |
| US2005191350 | Patent |
| WO2009138999 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:78246-49-8 | ChemIDplus |
| Citations |
|---|