EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O6 |
| Net Charge | -1 |
| Average Mass | 367.462 |
| Monoisotopic Mass | 367.21261 |
| SMILES | CC(O)CCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H]2C[C@H]1OO2 |
| InChI | InChI=1S/C20H32O6/c1-14(21)7-6-8-15(22)11-12-17-16(18-13-19(17)26-25-18)9-4-2-3-5-10-20(23)24/h2,4,11-12,14-19,21-22H,3,5-10,13H2,1H3,(H,23,24)/p-1/b4-2-,12-11+/t14?,15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | MTVPUJQVDLAVML-AHYYGCRPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10791960) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) has role human xenobiotic metabolite (CHEBI:76967) |
| 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) is a oxylipin anion (CHEBI:62933) |
| 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) is conjugate base of 19-hydroxyprostaglandin H2 (CHEBI:63912) |
| Incoming Relation(s) |
| 19-hydroxyprostaglandin H2 (CHEBI:63912) is conjugate acid of 19-hydroxyprostaglandin H2(1−) (CHEBI:90797) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,4S,5R,6R)-6-[(1E,3S)-3,7-dihydroxyoct-1-en-1-yl]-2,3-dioxabicyclo[2.2.1]heptan-5-yl}hept-5-enoate |
| UniProt Name | Source |
|---|---|
| 19-hydroxyprostaglandin H2 | UniProt |
| Citations |
|---|