EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29O2R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 313.454 |
| Monoisotopic Mass (excl. R groups) | 313.21676 |
| SMILES | *C(=O)OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinyl ester (CHEBI:63410) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl ester (CHEBI:63410) is a retinyl ester (CHEBI:16179) |
| all-trans-retinyl ester (CHEBI:63410) is a vitamin A (CHEBI:12777) |
| Incoming Relation(s) |
| all-trans-retinyl dodecanoate (CHEBI:140089) is a all-trans-retinyl ester (CHEBI:63410) |
| all-trans-retinyl heptanoate (CHEBI:138724) is a all-trans-retinyl ester (CHEBI:63410) |
| all-trans-retinyl octanoate (CHEBI:140084) is a all-trans-retinyl ester (CHEBI:63410) |
| all-trans-retinyl palmitate (CHEBI:17616) is a all-trans-retinyl ester (CHEBI:63410) |
| all-trans-retinyl tetradecanoate (CHEBI:138718) is a all-trans-retinyl ester (CHEBI:63410) |
| Synonym | Source |
|---|---|
| all-trans-retinyl esters | ChEBI |
| UniProt Name | Source |
|---|---|
| an all-trans-retinyl ester | UniProt |
| Manual Xrefs | Databases |
|---|---|
| All-trans-Retinyl-Esters | MetaCyc |
| C02075 | KEGG COMPOUND |
| HMDB0003598 | HMDB |
| Citations |
|---|