EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CO)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChIKey | FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Pandanus tectorius (ncbitaxon:4726) | - | PubMed (16923295) | |
| Taxus chinensis (ncbitaxon:29808) | - | PubMed (31776382) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinol (CHEBI:17336) has role human metabolite (CHEBI:77746) |
| all-trans-retinol (CHEBI:17336) has role mouse metabolite (CHEBI:75771) |
| all-trans-retinol (CHEBI:17336) has role plant metabolite (CHEBI:76924) |
| all-trans-retinol (CHEBI:17336) is a retinol (CHEBI:50211) |
| all-trans-retinol (CHEBI:17336) is a vitamin A (CHEBI:12777) |
| Incoming Relation(s) |
| all-trans-3-hydroxyretinol (CHEBI:156530) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-4-oxoretinol (CHEBI:44597) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-3,4-didehydroretinol (CHEBI:132246) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-4-hydroxyretinol (CHEBI:132259) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl ester (CHEBI:63410) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl linoleate (CHEBI:70762) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl oleate (CHEBI:70760) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl palmitate (CHEBI:17616) has functional parent all-trans-retinol (CHEBI:17336) |
| all-trans-retinyl stearate (CHEBI:70761) has functional parent all-trans-retinol (CHEBI:17336) |
| retinyl acetate (CHEBI:32095) has functional parent all-trans-retinol (CHEBI:17336) |
| IUPAC Name |
|---|
| all-trans-retinol |
| INNs | Source |
|---|---|
| retinol | WHO MedNet |
| retinol | WHO MedNet |
| rétinol | WHO MedNet |
| retinolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol | IUPAC |
| all-trans-Retinol | KEGG COMPOUND |
| (all-E)-3,7-dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen-1-ol | HMDB |
| all-trans retinol | ChemIDplus |
| all-trans-vitamin A | ChemIDplus |
| all-trans-retinyl alcohol | ChemIDplus |
| Brand Names | Source |
|---|---|
| Alphalin | ChemIDplus |
| Aquasol A | KEGG DRUG |
| Chocola A | ChemIDplus |
| UniProt Name | Source |
|---|---|
| all-trans-retinol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:247497 | Gmelin |
| Beilstein:403040 | Beilstein |
| CAS:11103-57-4 | ChemIDplus |
| CAS:68-26-8 | KEGG COMPOUND |
| CAS:68-26-8 | ChemIDplus |
| CAS:68-26-8 | NIST Chemistry WebBook |
| Citations |
|---|