EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O2 |
| Net Charge | 0 |
| Average Mass | 412.658 |
| Monoisotopic Mass | 412.33413 |
| SMILES | CCCCCCCC(=O)OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C28H44O2/c1-7-8-9-10-11-17-27(29)30-22-20-24(3)15-12-14-23(2)18-19-26-25(4)16-13-21-28(26,5)6/h12,14-15,18-20H,7-11,13,16-17,21-22H2,1-6H3/b15-12+,19-18+,23-14+,24-20+ |
| InChIKey | AWGMQQGZWRIUJI-UBMBPVGBSA-N |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinyl octanoate (CHEBI:140084) is a all-trans-retinyl ester (CHEBI:63410) |
| all-trans-retinyl octanoate (CHEBI:140084) is a octanoate ester (CHEBI:87657) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-yl octanoate |
| Synonyms | Source |
|---|---|
| O15-octanoylretinol | ChEBI |
| retinyl octanoate | ChEBI |
| vitamin A octanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| all-trans-retinyl octanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4509574 | ChemSpider |
| Citations |
|---|