EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O2 |
| Net Charge | 0 |
| Average Mass | 398.631 |
| Monoisotopic Mass | 398.31848 |
| SMILES | CCCCCCC(=O)OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C27H42O2/c1-7-8-9-10-16-26(28)29-21-19-23(3)14-11-13-22(2)17-18-25-24(4)15-12-20-27(25,5)6/h11,13-14,17-19H,7-10,12,15-16,20-21H2,1-6H3/b14-11+,18-17+,22-13+,23-19+ |
| InChIKey | QLFIHDFIMGLXEA-XOEOKOMISA-N |
| Roles Classification |
|---|
| Biological Roles: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinyl heptanoate (CHEBI:138724) has functional parent heptanoic acid (CHEBI:45571) |
| all-trans-retinyl heptanoate (CHEBI:138724) is a all-trans-retinyl ester (CHEBI:63410) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-yl heptanoate |
| Synonyms | Source |
|---|---|
| O-heptanoyl-all-trans-retinol | SUBMITTER |
| retinyl heptanoate | ChemIDplus |
| retinol heptanoate | ChEBI |
| vitamin A heptanoate | ChEBI |
| O15-heptanoylretinol | ChEBI |
| UniProt Name | Source |
|---|---|
| all-trans-retinyl heptanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 9513447 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13669311 | Reaxys |
| CAS:88641-44-5 | ChemIDplus |
| Citations |
|---|