EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2Se |
| Net Charge | 0 |
| Average Mass | 168.054 |
| Monoisotopic Mass | 168.96420 |
| SMILES | N[C@@H](C[SeH])C(=O)O |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | ZKZBPNGNEQAJSX-REOHCLBHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (11733012) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenocysteine (CHEBI:16633) has role human metabolite (CHEBI:77746) |
| L-selenocysteine (CHEBI:16633) is a L-alanine derivative (CHEBI:83943) |
| L-selenocysteine (CHEBI:16633) is a L-α-amino acid (CHEBI:15705) |
| L-selenocysteine (CHEBI:16633) is a proteinogenic amino acid (CHEBI:83813) |
| L-selenocysteine (CHEBI:16633) is a selenocysteine (CHEBI:9093) |
| L-selenocysteine (CHEBI:16633) is conjugate acid of L-selenocysteinate(1−) (CHEBI:32742) |
| L-selenocysteine (CHEBI:16633) is conjugate base of L-selenocysteinium (CHEBI:32744) |
| L-selenocysteine (CHEBI:16633) is enantiomer of D-selenocysteine (CHEBI:30001) |
| L-selenocysteine (CHEBI:16633) is tautomer of L-selenocysteine zwitterion (CHEBI:57843) |
| Incoming Relation(s) |
| L-selenocysteine derivative (CHEBI:84209) has functional parent L-selenocysteine (CHEBI:16633) |
| L-selenocysteinium (CHEBI:32744) is conjugate acid of L-selenocysteine (CHEBI:16633) |
| L-selenocysteinate(1−) (CHEBI:32742) is conjugate base of L-selenocysteine (CHEBI:16633) |
| D-selenocysteine (CHEBI:30001) is enantiomer of L-selenocysteine (CHEBI:16633) |
| L-selenocysteine residue (CHEBI:30000) is substituent group from L-selenocysteine (CHEBI:16633) |
| L-selenocysteino group (CHEBI:32746) is substituent group from L-selenocysteine (CHEBI:16633) |
| L-selenocysteinyl group (CHEBI:32745) is substituent group from L-selenocysteine (CHEBI:16633) |
| L-selenocysteine zwitterion (CHEBI:57843) is tautomer of L-selenocysteine (CHEBI:16633) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-selanylpropanoic acid |
| Synonyms | Source |
|---|---|
| 3-selenyl-L-alanine | ChemIDplus |
| L-Selenocysteine | KEGG COMPOUND |
| Selenocysteine | ChemIDplus |
| SELENOCYSTEINE | PDBeChem |
| L-Selenocystein | ChEBI |
| L-Selenozystein | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05688 | KEGG COMPOUND |
| ECMDB03288 | ECMDB |
| HMDB0003288 | HMDB |
| L-SELENOCYSTEINE | MetaCyc |
| SEC | PDBeChem |
| Selenocysteine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2498378 | Reaxys |
| CAS:10236-58-5 | ChemIDplus |
| CAS:10236-58-5 | KEGG COMPOUND |
| Citations |
|---|