EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8NO2Se |
| Net Charge | +1 |
| Average Mass | 169.062 |
| Monoisotopic Mass | 169.97148 |
| SMILES | [NH3+][C@@H](C[SeH])C(=O)O |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p+1/t2-/m0/s1 |
| InChIKey | ZKZBPNGNEQAJSX-REOHCLBHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenocysteinium (CHEBI:32744) is a selenocysteinium (CHEBI:32754) |
| L-selenocysteinium (CHEBI:32744) is conjugate acid of L-selenocysteine (CHEBI:16633) |
| L-selenocysteinium (CHEBI:32744) is enantiomer of D-selenocysteinium (CHEBI:32751) |
| Incoming Relation(s) |
| L-selenocysteine (CHEBI:16633) is conjugate base of L-selenocysteinium (CHEBI:32744) |
| D-selenocysteinium (CHEBI:32751) is enantiomer of L-selenocysteinium (CHEBI:32744) |
| IUPAC Name |
|---|
| (1R)-1-carboxy-2-selanylethanaminium |
| Synonyms | Source |
|---|---|
| L-selenocysteine cation | JCBN |
| L-selenocysteinium | JCBN |
| L-selenocysteinium(1+) | ChEBI |