EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2Se |
| Net Charge | -1 |
| Average Mass | 167.046 |
| Monoisotopic Mass | 167.95692 |
| SMILES | N[C@@H](C[SeH])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-1/t2-/m0/s1 |
| InChIKey | ZKZBPNGNEQAJSX-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-selenocysteinate(1−) (CHEBI:32742) is a selenocysteinate(1−) (CHEBI:32752) |
| L-selenocysteinate(1−) (CHEBI:32742) is conjugate acid of L-selenocysteinate(2−) (CHEBI:32743) |
| L-selenocysteinate(1−) (CHEBI:32742) is conjugate base of L-selenocysteine (CHEBI:16633) |
| L-selenocysteinate(1−) (CHEBI:32742) is enantiomer of D-selenocysteinate(1−) (CHEBI:32747) |
| Incoming Relation(s) |
| L-selenocysteine (CHEBI:16633) is conjugate acid of L-selenocysteinate(1−) (CHEBI:32742) |
| L-selenocysteinate(2−) (CHEBI:32743) is conjugate base of L-selenocysteinate(1−) (CHEBI:32742) |
| D-selenocysteinate(1−) (CHEBI:32747) is enantiomer of L-selenocysteinate(1−) (CHEBI:32742) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-selanylpropanoate |
| Synonyms | Source |
|---|---|
| hydrogen L-selenocysteinate | JCBN |
| L-selenocysteinate(1−) | JCBN |
| L-selenocysteine monoanion | JCBN |