EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2Se |
| Net Charge | 0 |
| Average Mass | 168.054 |
| Monoisotopic Mass | 168.96420 |
| SMILES | N[C@H](C[SeH])C(=O)O |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | ZKZBPNGNEQAJSX-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-selenocysteine (CHEBI:30001) is a D-α-amino acid (CHEBI:16733) |
| D-selenocysteine (CHEBI:30001) is a selenocysteine (CHEBI:9093) |
| D-selenocysteine (CHEBI:30001) is conjugate acid of D-selenocysteinate(1−) (CHEBI:32747) |
| D-selenocysteine (CHEBI:30001) is conjugate base of D-selenocysteinium (CHEBI:32751) |
| D-selenocysteine (CHEBI:30001) is enantiomer of L-selenocysteine (CHEBI:16633) |
| Incoming Relation(s) |
| D-selenocysteine derivative (CHEBI:84210) has functional parent D-selenocysteine (CHEBI:30001) |
| D-selenocysteinium (CHEBI:32751) is conjugate acid of D-selenocysteine (CHEBI:30001) |
| D-selenocysteinate(1−) (CHEBI:32747) is conjugate base of D-selenocysteine (CHEBI:30001) |
| L-selenocysteine (CHEBI:16633) is enantiomer of D-selenocysteine (CHEBI:30001) |
| D-selenocysteine residue (CHEBI:30002) is substituent group from D-selenocysteine (CHEBI:30001) |
| D-selenocysteino group (CHEBI:32748) is substituent group from D-selenocysteine (CHEBI:30001) |
| D-selenocysteinyl group (CHEBI:32749) is substituent group from D-selenocysteine (CHEBI:30001) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-selanylpropanoic acid |
| Synonyms | Source |
|---|---|
| D-Selenocystein | ChEBI |
| D-selenocysteine | JCBN |
| D-Selenozystein | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6965000 | Beilstein |