EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:9093 - selenocysteine
| Formula | C3H7NO2Se |
| Net Charge | 0 |
| Average Mass | 168.054 |
| Monoisotopic Mass | 168.96420 |
| SMILES | NC(C[SeH])C(=O)O |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| InChIKey | ZKZBPNGNEQAJSX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenocysteine (CHEBI:9093) has part selanylmethyl group (CHEBI:50327) |
| selenocysteine (CHEBI:9093) has role human metabolite (CHEBI:77746) |
| selenocysteine (CHEBI:9093) is a α-amino acid (CHEBI:33704) |
| selenocysteine (CHEBI:9093) is conjugate acid of selenocysteinate(1−) (CHEBI:32752) |
| selenocysteine (CHEBI:9093) is conjugate base of selenocysteinium (CHEBI:32754) |
| Incoming Relation(s) |
| Se-L-selenocysteine-S-L-cysteine residue (CHEBI:142235) has functional parent selenocysteine (CHEBI:9093) |
| selenocysteine derivative (CHEBI:84208) has functional parent selenocysteine (CHEBI:9093) |
| selenocystine (CHEBI:28553) has functional parent selenocysteine (CHEBI:9093) |
| D-selenocysteine (CHEBI:30001) is a selenocysteine (CHEBI:9093) |
| L-selenocysteine (CHEBI:16633) is a selenocysteine (CHEBI:9093) |
| selenocysteinium (CHEBI:32754) is conjugate acid of selenocysteine (CHEBI:9093) |
| selenocysteinate(1−) (CHEBI:32752) is conjugate base of selenocysteine (CHEBI:9093) |
| selenocysteine residue (CHEBI:32757) is substituent group from selenocysteine (CHEBI:9093) |
| selenocysteino group (CHEBI:32756) is substituent group from selenocysteine (CHEBI:9093) |
| selenocysteinyl group (CHEBI:32755) is substituent group from selenocysteine (CHEBI:9093) |
| IUPAC Name |
|---|
| 2-amino-3-selanylpropanoic acid |
| Synonyms | Source |
|---|---|
| 3-selenoalanine | ChemIDplus |
| Selenocystein | ChEBI |
| Selenocysteine | KEGG COMPOUND |
| Selenozystein | ChEBI |
| Citations |
|---|