EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O5S |
| Net Charge | 0 |
| Average Mass | 352.412 |
| Monoisotopic Mass | 352.10929 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)O)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C16H20N2O5S/c1-16(2)12(15(22)23)18-13(24-16)11(14(20)21)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-13,18H,8H2,1-2H3,(H,17,19)(H,20,21)(H,22,23)/t11-,12-,13+/m0/s1 |
| InChIKey | HCYWNSXLUZRKJX-RWMBFGLXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloic acid (CHEBI:61222) has role epitope (CHEBI:53000) |
| benzylpenicilloic acid (CHEBI:61222) is a penicilloic acid (CHEBI:7968) |
| benzylpenicilloic acid (CHEBI:61222) is conjugate acid of benzylpenicilloate(1−) (CHEBI:61220) |
| benzylpenicilloic acid (CHEBI:61222) is conjugate acid of benzylpenicilloate(2−) (CHEBI:63418) |
| Incoming Relation(s) |
| benzylpenicilloate(1−) (CHEBI:61220) is conjugate base of benzylpenicilloic acid (CHEBI:61222) |
| benzylpenicilloate(2−) (CHEBI:63418) is conjugate base of benzylpenicilloic acid (CHEBI:61222) |
| IUPAC Name |
|---|
| (2R,4S)-2-{(R)-carboxy[(phenylacetyl)amino]methyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| D-benzylpenicilloic acid | ChEBI |
| 4-carboxy-5,5-dimethyl-alpha-((phenylacetyl)amino)-2-thiazolidineacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:95553 | Reaxys |
| CAS:13057-98-2 | ChemIDplus |
| Citations |
|---|