EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O5SR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 261.275 |
| Monoisotopic Mass (excl. R groups) | 261.05452 |
| SMILES | *C(=O)N[C@H](C(=O)O)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicilloic acid (CHEBI:7968) is a thiazolidinedicarboxylic acid (CHEBI:36176) |
| penicilloic acid (CHEBI:7968) is conjugate acid of penicilloate(2−) (CHEBI:62524) |
| Incoming Relation(s) |
| benzylpenicilloic acid (CHEBI:61222) is a penicilloic acid (CHEBI:7968) |
| penicilloate(2−) (CHEBI:62524) is conjugate base of penicilloic acid (CHEBI:7968) |
| Synonym | Source |
|---|---|
| penicilloic acids | ChEBI |
| Citations |
|---|