EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O5S |
| Net Charge | -2 |
| Average Mass | 350.396 |
| Monoisotopic Mass | 350.09474 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)[O-])N[C@@H](C(=O)[O-])C(C)(C)S1 |
| InChI | InChI=1S/C16H20N2O5S/c1-16(2)12(15(22)23)18-13(24-16)11(14(20)21)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-13,18H,8H2,1-2H3,(H,17,19)(H,20,21)(H,22,23)/p-2/t11-,12-,13+/m0/s1 |
| InChIKey | HCYWNSXLUZRKJX-RWMBFGLXSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloate(2−) (CHEBI:63418) is a penicilloate(2−) (CHEBI:62524) |
| benzylpenicilloate(2−) (CHEBI:63418) is conjugate base of benzylpenicilloic acid (CHEBI:61222) |
| Incoming Relation(s) |
| benzylpenicilloic acid (CHEBI:61222) is conjugate acid of benzylpenicilloate(2−) (CHEBI:63418) |
| IUPAC Name |
|---|
| (2R,4S)-2-{(R)-carboxylato[(phenylacetyl)amino]methyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
| Synonym | Source |
|---|---|
| benzylpenicilloate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6075892 | Reaxys |
| Citations |
|---|