EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O5S |
| Net Charge | -1 |
| Average Mass | 351.404 |
| Monoisotopic Mass | 351.10202 |
| SMILES | [H][C@@]1([C@H](NC(=O)Cc2ccccc2)C(=O)[O-])[NH2+][C@@H](C(=O)[O-])C(C)(C)S1 |
| InChI | InChI=1S/C16H20N2O5S/c1-16(2)12(15(22)23)18-13(24-16)11(14(20)21)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-13,18H,8H2,1-2H3,(H,17,19)(H,20,21)(H,22,23)/p-1/t11-,12-,13+/m0/s1 |
| InChIKey | HCYWNSXLUZRKJX-RWMBFGLXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicilloate(1−) (CHEBI:61220) is a penicilloate anion (CHEBI:61221) |
| benzylpenicilloate(1−) (CHEBI:61220) is conjugate base of benzylpenicilloic acid (CHEBI:61222) |
| Incoming Relation(s) |
| monosodium benzylpenicilloate (CHEBI:61217) has part benzylpenicilloate(1−) (CHEBI:61220) |
| benzylpenicilloic acid (CHEBI:61222) is conjugate acid of benzylpenicilloate(1−) (CHEBI:61220) |
| IUPAC Name |
|---|
| (2R,4S)-2-{(R)-carboxylato[(phenylacetyl)amino]methyl}-5,5-dimethyl-1,3-thiazolidin-3-ium-4-carboxylate |
| Synonyms | Source |
|---|---|
| benzylpenicilloate anion | ChEBI |
| benzylpenicilloate | ChEBI |
| 4-carboxy-5,5-dimethyl-alpha-((phenylacetyl)amino)-2-thiazolidineacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:13057-98-2 | ChemIDplus |