EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C8H11NO4S)n.C2H6N2O2 |
| Net Charge | 0 |
| Average Mass | 307.328 |
| Monoisotopic Mass | 307.08381 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytochelatin (CHEBI:60836) has functional parent glutathione (CHEBI:16856) |
| phytochelatin (CHEBI:60836) has role chelator (CHEBI:38161) |
| phytochelatin (CHEBI:60836) has role metabolite (CHEBI:25212) |
| phytochelatin (CHEBI:60836) is a peptide (CHEBI:16670) |
| Incoming Relation(s) |
| phytochelatin 2 (CHEBI:64744) is a phytochelatin (CHEBI:60836) |
| phytochelatin 3 (CHEBI:64745) is a phytochelatin (CHEBI:60836) |
| phytochelatin 4 (CHEBI:64747) is a phytochelatin (CHEBI:60836) |
| Synonym | Source |
|---|---|
| phytochelatins | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Phytochelatin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:98726-08-0 | ChemIDplus |
| Citations |
|---|