EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H53N9O18S4 |
| Net Charge | 0 |
| Average Mass | 1004.111 |
| Monoisotopic Mass | 1003.23914 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C34H53N9O18S4/c35-14(31(54)55)1-5-22(44)38-19(11-63)28(51)41-16(33(58)59)3-7-24(46)40-21(13-65)30(53)43-17(34(60)61)4-8-25(47)39-20(12-64)29(52)42-15(32(56)57)2-6-23(45)37-18(10-62)27(50)36-9-26(48)49/h14-21,62-65H,1-13,35H2,(H,36,50)(H,37,45)(H,38,44)(H,39,47)(H,40,46)(H,41,51)(H,42,52)(H,43,53)(H,48,49)(H,54,55)(H,56,57)(H,58,59)(H,60,61)/t14-,15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | RXJVIYXWFHKGJE-QKSWPAOXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytochelatin 4 (CHEBI:64747) is a oligopeptide (CHEBI:25676) |
| phytochelatin 4 (CHEBI:64747) is a phytochelatin (CHEBI:60836) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| PC4 | SUBMITTER |
| PC4 | ChEBI |
| H-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-Gly-OH | ChEBI |
| H-(γ-Glu-Cys)4-Gly-OH | ChEBI |
| γGlu-Cys-γGlu-Cys-γGlu-Cys-γGlu-Cys-Gly | ChEBI |
| (γ-Glu-Cys)4-Gly | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4289225 | Reaxys |
| Citations |
|---|