EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41N7O14S3 |
| Net Charge | 0 |
| Average Mass | 771.850 |
| Monoisotopic Mass | 771.18736 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H41N7O14S3/c27-11(24(42)43)1-4-17(34)30-15(9-49)22(40)32-13(26(46)47)3-6-19(36)31-16(10-50)23(41)33-12(25(44)45)2-5-18(35)29-14(8-48)21(39)28-7-20(37)38/h11-16,48-50H,1-10,27H2,(H,28,39)(H,29,35)(H,30,34)(H,31,36)(H,32,40)(H,33,41)(H,37,38)(H,42,43)(H,44,45)(H,46,47)/t11-,12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | PCOMFCPXXQONPD-QNILMXGZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytochelatin 3 (CHEBI:64745) is a oligopeptide (CHEBI:25676) |
| phytochelatin 3 (CHEBI:64745) is a phytochelatin (CHEBI:60836) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| H-(γ-Glu-Cys)3-Gly-OH | ChEBI |
| H-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-Gly-OH | ChEBI |
| (γ-Glu-Cys)3-Gly | ChEBI |
| γGlu-Cys-γGlu-Cys-γGlu-Cys-Gly | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4290191 | Reaxys |
| Citations |
|---|