EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N5O10S2 |
| Net Charge | 0 |
| Average Mass | 539.589 |
| Monoisotopic Mass | 539.13558 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H29N5O10S2/c19-8(17(30)31)1-3-12(24)22-11(7-35)16(29)23-9(18(32)33)2-4-13(25)21-10(6-34)15(28)20-5-14(26)27/h8-11,34-35H,1-7,19H2,(H,20,28)(H,21,25)(H,22,24)(H,23,29)(H,26,27)(H,30,31)(H,32,33)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | CGZITCMVSSNQPE-NAKRPEOUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phytochelatin 2 (CHEBI:64744) is a pentapeptide (CHEBI:48545) |
| phytochelatin 2 (CHEBI:64744) is a phytochelatin (CHEBI:60836) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| PC2 | SUBMITTER |
| PC2 | ChEBI |
| H-γ-L-Glu-L-Cys-γ-L-Glu-L-Cys-Gly-OH | ChEBI |
| γGlu-Cys-γGlu-Cys-Gly | ChEBI |
| H-(γ-Glu-Cys)2-Gly-OH | ChEBI |
| (γ-Glu-Cys)2-Gly | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4303219 | Reaxys |
| Citations |
|---|