EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)ccc1O |
| InChI | InChI=1S/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
| InChIKey | IZQSVPBOUDKVDZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isorhamnetin (CHEBI:6052) has functional parent quercetin (CHEBI:16243) |
| isorhamnetin (CHEBI:6052) has role anticoagulant (CHEBI:50249) |
| isorhamnetin (CHEBI:6052) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| isorhamnetin (CHEBI:6052) has role metabolite (CHEBI:25212) |
| isorhamnetin (CHEBI:6052) is a 7-hydroxyflavonol (CHEBI:52267) |
| isorhamnetin (CHEBI:6052) is a monomethoxyflavone (CHEBI:25401) |
| isorhamnetin (CHEBI:6052) is a tetrahydroxyflavone (CHEBI:38684) |
| isorhamnetin (CHEBI:6052) is conjugate acid of isorhamnetin(1−) (CHEBI:144055) |
| Incoming Relation(s) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-α-L-[6''''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66097) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-D-galactopyranoside (CHEBI:75751) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-L-galactopyranoside (CHEBI:75777) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 4'-O-β-D-glucopyranoside (CHEBI:75783) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 4'-O-β-L-glucopyranoside (CHEBI:75778) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 7-O-β-D-glucopyranoside (CHEBI:75752) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 7-O-β-L-glucopyranoside (CHEBI:75773) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin(1−) (CHEBI:144055) is conjugate base of isorhamnetin (CHEBI:6052) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,5,7,4'-tetrahydroxy-3'-methoxyflavone | ChEBI |
| 3,5,7-trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-benzopyran-4-one | ChEBI |
| 3-Methylquercetin | KEGG COMPOUND |
| Isorhamnetin | KEGG COMPOUND |
| Isorhamnetol | ChemIDplus |
| Quercetin 3'-methyl ether | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004635 | KNApSAcK |
| C10084 | KEGG COMPOUND |
| CN102614094 | Patent |
| CPD-8004 | MetaCyc |
| HMDB0002655 | HMDB |
| Isorhamnetin | Wikipedia |
| LMPK12110002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:44723 | Reaxys |
| CAS:480-19-3 | KEGG COMPOUND |
| CAS:480-19-3 | ChemIDplus |
| Citations |
|---|