EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22+/m0/s1 |
| InChIKey | CQLRUIIRRZYHHS-CQDSFZKYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) has functional parent β-L-glucose (CHEBI:37631) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) has role metabolite (CHEBI:25212) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) is a glycosyloxyflavone (CHEBI:50018) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) is a monomethoxyflavone (CHEBI:25401) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) is a monosaccharide derivative (CHEBI:63367) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) is a trihydroxyflavone (CHEBI:27116) |
| isorhamnetin 3-O-β-L-glucopyranoside (CHEBI:75758) is a β-L-glucoside (CHEBI:75759) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl β-L-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1360450 | Reaxys |