EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O16 |
| Net Charge | 0 |
| Average Mass | 624.548 |
| Monoisotopic Mass | 624.16903 |
| SMILES | [H][C@@]1(OC[C@H]2OC(Oc3c(-c4ccc(O)c(OC)c4)oc4cc(O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9-,16+,18-,19-,21+,22-,23+,24+,27+,28?/m0/s1 |
| InChIKey | UIDGLYUNOUKLBM-IDQQZYJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia capillaris (ncbitaxon:265783) | - | PubMed (22870812) | |
| Convolvulus tricolor (ncbitaxon:4124) | seed (BTO:0001226) | PubMed (22908568) | |
| Nitraria retusa (ncbitaxon:43875) | leaf (BTO:0000713) | PubMed (22913434) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) has role antioxidant (CHEBI:22586) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) has role apoptosis inducer (CHEBI:68495) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) has role plant metabolite (CHEBI:76924) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) is a disaccharide derivative (CHEBI:63353) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) is a glycosyloxyflavone (CHEBI:50018) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) is a monomethoxyflavone (CHEBI:25401) |
| isorhamnetin 3-O-robinobioside (CHEBI:132898) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 6-O-(6-deoxy-α-L-mannopyranosyl)-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| isorhamnetin-3-O-robinobioside | SUBMITTER |
| Isorhamnetin 3-robinobioside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00005538 | KNApSAcK |
| LMPK12112321 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6682110 | Reaxys |
| CAS:53584-69-3 | ChemIDplus |
| Citations |
|---|