EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22+/m1/s1 |
| InChIKey | CQLRUIIRRZYHHS-LFXZADKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) has functional parent isorhamnetin (CHEBI:6052) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) has functional parent β-D-glucose (CHEBI:15903) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) has role metabolite (CHEBI:25212) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) is a glycosyloxyflavone (CHEBI:50018) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) is a monomethoxyflavone (CHEBI:25401) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) is a monosaccharide derivative (CHEBI:63367) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) is a trihydroxyflavone (CHEBI:27116) |
| isorhamnetin 3-O-β-D-glucopyranoside (CHEBI:75750) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| isorhamnetin-3-glucoside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 4477169 | ChemSpider |
| LMPK12110576 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1303772 | Reaxys |