EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11I3NO4 |
| Net Charge | -1 |
| Average Mass | 649.968 |
| Monoisotopic Mass | 649.78278 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/p-1/t12-/m0/s1 |
| InChIKey | AUYYCJSJGJYCDS-LBPRGKRZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is a iodothyroninate (CHEBI:63477) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is a monocarboxylic acid anion (CHEBI:35757) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is a α-amino-acid anion (CHEBI:33558) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is conjugate base of 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| Incoming Relation(s) |
| liothyronine sodium (CHEBI:6484) has part 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| thyroxine sulfate(1−) (CHEBI:58910) is a 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is conjugate acid of 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
| Synonyms | Source |
|---|---|
| liothyronine(1−) | ChEBI |
| liothyronine anion | ChEBI |
| (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propionate | ChEBI |
| 3,3',5-triiodo-L-thyronine anion | ChEBI |
| 3,3',5-triiodo-L-thyronine(1−) | ChEBI |