EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6484 - liothyronine sodium
| Formula | C15H11I3NO4.Na |
| Net Charge | 0 |
| Average Mass | 672.958 |
| Monoisotopic Mass | 672.77200 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H12I3NO4.Na/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22;/h1-4,6,12,20H,5,19H2,(H,21,22);/q;+1/p-1/t12-;/m0./s1 |
| InChIKey | SBXXSUDPJJJJLC-YDALLXLXSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liothyronine sodium (CHEBI:6484) has part 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| liothyronine sodium (CHEBI:6484) has role antineoplastic agent (CHEBI:35610) |
| liothyronine sodium (CHEBI:6484) has role cardiovascular drug (CHEBI:35554) |
| liothyronine sodium (CHEBI:6484) has role immunosuppressive agent (CHEBI:35705) |
| liothyronine sodium (CHEBI:6484) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
| Synonyms | Source |
|---|---|
| 3,3',5-Triiodo-L-thyronine sodium | ChemIDplus |
| 3,3',5-Triiodothyronine sodium salt | ChemIDplus |
| Basoprocin | ChEMBL |
| Cytobin | ChEMBL |
| Ibiothyron | ChEMBL |
| Liothyronine hydrochloride | ChEMBL |
| Brand Names | Source |
|---|---|
| Cynomel | ChEMBL |
| Cytomel | DrugBank |
| Tertroxin | DrugBank |
| Thybon | ChEMBL |
| Tresitope | DrugBank |
| Triiodothyronine,evans | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01011 | KEGG DRUG |
| Liothyronine_Sodium | Wikipedia |
| US2002193440 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8179867 | Reaxys |
| CAS:55-06-1 | ChemIDplus |
| Citations |
|---|