EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10I4NO7S |
| Net Charge | -1 |
| Average Mass | 855.928 |
| Monoisotopic Mass | 855.63624 |
| SMILES | [NH3+]C(Cc1cc(I)c(Oc2cc(I)c(OS(=O)(=O)[O-])c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H11I4NO7S/c16-8-1-6(3-12(20)15(21)22)2-9(17)13(8)26-7-4-10(18)14(11(19)5-7)27-28(23,24)25/h1-2,4-5,12H,3,20H2,(H,21,22)(H,23,24,25)/p-1 |
| InChIKey | QYXIJUZWSSQICT-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thyroxine sulfate(1−) (CHEBI:58910) is a 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| thyroxine sulfate(1−) (CHEBI:58910) is a phenyl sulfate oxoanion (CHEBI:140317) |
| thyroxine sulfate(1−) (CHEBI:58910) is conjugate base of thyroxine sulfate (CHEBI:53508) |
| Incoming Relation(s) |
| L-thyroxine sulfate(1−) (CHEBI:176512) is a thyroxine sulfate(1−) (CHEBI:58910) |
| thyroxine sulfate (CHEBI:53508) is conjugate acid of thyroxine sulfate(1−) (CHEBI:58910) |
| IUPAC Name |
|---|
| 2-azaniumyl-3-{4-[3,5-diiodo-4-(sulfonatooxy)phenoxy]-3,5-diiodophenyl}propanoate |
| UniProt Name | Source |
|---|---|
| thyroxine sulfate | UniProt |