EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I3NO4 |
| Net Charge | 0 |
| Average Mass | 650.976 |
| Monoisotopic Mass | 650.79005 |
| SMILES | N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | AUYYCJSJGJYCDS-LBPRGKRZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | thyroid hormone Any hormone produced by the thyroid gland mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role human metabolite (CHEBI:77746) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role mouse metabolite (CHEBI:75771) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) has role thyroid hormone (CHEBI:60311) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a 2-halophenol (CHEBI:53291) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a iodophenol (CHEBI:24863) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is a iodothyronine (CHEBI:24864) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is conjugate acid of 3,3',5-triiodo-L-thyroninate (CHEBI:60308) |
| 3,3',5-triiodo-L-thyronine (CHEBI:18258) is tautomer of 3,3',5-triiodo-L-thyronine zwitterion (CHEBI:533015) |
| Incoming Relation(s) |
| 3,3',5-triiodo-L-thyronine sulfate (CHEBI:35432) has functional parent 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| desiccated thyroid extract (CHEBI:9584) has part 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyroninate (CHEBI:60308) is conjugate base of 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyronine residue (CHEBI:90874) is substituent group from 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| 3,3',5-triiodo-L-thyronine zwitterion (CHEBI:533015) is tautomer of 3,3',5-triiodo-L-thyronine (CHEBI:18258) |
| IUPAC Name |
|---|
| 3,3',5-triiodo-L-thyronine |
| INNs | Source |
|---|---|
| liothyroninum | ChemIDplus |
| liotironina | ChemIDplus |
| liothyronine | ChEBI |
| liothyronine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Triiodothyronine | KEGG COMPOUND |
| L-3,5,3'-Triiodothyronine | KEGG COMPOUND |
| 3,5,3'-Triiodothyronine | KEGG COMPOUND |
| Liothyronine | KEGG COMPOUND |
| 4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine | IUPAC |
| O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine | IUPAC |
| Brand Names | Source |
|---|---|
| Tresitope | DrugBank |
| Tertroxin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C02465 | KEGG COMPOUND |
| T3 | PDBeChem |
| DB00279 | DrugBank |
| HMDB0000265 | HMDB |
| Triiodothyronine | Wikipedia |
| D08128 | KEGG DRUG |
| LSM-3991 | LINCS |
| 1585 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2710227 | Reaxys |
| CAS:6893-02-3 | KEGG COMPOUND |
| CAS:6893-02-3 | ChemIDplus |
| Citations |
|---|