EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4NO4 |
| Net Charge | -1 |
| Average Mass | 142.090 |
| Monoisotopic Mass | 142.01458 |
| SMILES | O=CNC(=O)/C=C\C(=O)[O-] |
| InChI | InChI=1S/C5H5NO4/c7-3-6-4(8)1-2-5(9)10/h1-3H,(H,9,10)(H,6,7,8)/p-1/b2-1- |
| InChIKey | HSKSAKBZUITULZ-UPHRSURJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylmaleamate (CHEBI:59911) has functional parent maleamate (CHEBI:16146) |
| N-formylmaleamate (CHEBI:59911) is a monocarboxylic acid anion (CHEBI:35757) |
| N-formylmaleamate (CHEBI:59911) is conjugate base of N-formylmaleamic acid (CHEBI:59930) |
| Incoming Relation(s) |
| N-formylmaleamic acid (CHEBI:59930) is conjugate acid of N-formylmaleamate (CHEBI:59911) |
| IUPAC Name |
|---|
| (2Z)-4-formamido-4-oxobut-2-enoate |
| Synonyms | Source |
|---|---|
| N-formylmaleamate anion | ChEBI |
| (Z)-4-formamido-4-oxobut-2-enoate | ChEBI |
| UniProt Name | Source |
|---|---|
| N-formylmaleamate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11657932 | Beilstein |
| Citations |
|---|