EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H41N5O5.CH4O3S |
| Net Charge | 0 |
| Average Mass | 707.850 |
| Monoisotopic Mass | 707.29888 |
| SMILES | CS(=O)(=O)O.[H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C35H41N5O5.CH4O3S/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34;1-5(2,3)4/h4-7,9-12,18,20,23,25,27-29,36,44H,8,13-17,19H2,1-3H3,(H,37,41);1H3,(H,2,3,4)/t23-,25-,27-,28+,29+,34-,35+;/m1./s1 |
| InChIKey | SPXACGZWWVIDGR-SPZWACKZSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroergocristine mesylate (CHEBI:31490) has part dihydroergocristine (CHEBI:59912) |
| dihydroergocristine mesylate (CHEBI:31490) has role geroprotector (CHEBI:176497) |
| dihydroergocristine mesylate (CHEBI:31490) has role vasodilator agent (CHEBI:35620) |
| dihydroergocristine mesylate (CHEBI:31490) has role α-adrenergic antagonist (CHEBI:37890) |
| dihydroergocristine mesylate (CHEBI:31490) is a methanesulfonate salt (CHEBI:38037) |
| Incoming Relation(s) |
| ergoloid mesylate (CHEBI:34706) has part dihydroergocristine mesylate (CHEBI:31490) |
| IUPAC Name |
|---|
| (10αH)-5'α-benzyl-12'-hydroxy-3',6',18-trioxo-2'-(propan-2-yl)-9,10-dihydroergotaman methanesulfonate |
| Synonyms | Source |
|---|---|
| 5'alpha-Benzyl-9,10alpha-dihydro-12'-hydroxy-2'-isopropylergotaman-3',6',18-trione monomethanesulphonate | KEGG COMPOUND |
| 9,10-dihydroergocristine mesilate | ChEBI |
| 9,10-dihydroergocristine mesylate | ChEBI |
| 9,10-dihydroergocristine methanesulfonate | ChemIDplus |
| dihydroergocristine mesilate | ChEBI |
| Dihydroergocristine mesylate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 392057 | ChemSpider |
| C13168 | KEGG COMPOUND |
| D07833 | KEGG DRUG |
| DBSALT002618 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3896115 | Beilstein |
| CAS:24730-10-7 | KEGG COMPOUND |
| CAS:24730-10-7 | ChemIDplus |
| Citations |
|---|