EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H41N5O5.CH4O3S |
| Net Charge | 0 |
| Average Mass | 707.850 |
| Monoisotopic Mass | 707.29888 |
| SMILES | CS(=O)(=O)O.[H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C35H41N5O5.CH4O3S/c1-20(2)34(37-31(41)23-16-25-24-11-7-12-26-30(24)22(18-36-26)17-27(25)38(3)19-23)33(43)40-28(15-21-9-5-4-6-10-21)32(42)39-14-8-13-29(39)35(40,44)45-34;1-5(2,3)4/h4-7,9-12,18,20,23,25,27-29,36,44H,8,13-17,19H2,1-3H3,(H,37,41);1H3,(H,2,3,4)/t23-,25-,27-,28+,29+,34-,35+;/m1./s1 |
| InChIKey | SPXACGZWWVIDGR-SPZWACKZSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. vasodilator agent A drug used to cause dilation of the blood vessels. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroergocristine mesylate (CHEBI:31490) has part dihydroergocristine (CHEBI:59912) |
| dihydroergocristine mesylate (CHEBI:31490) has role geroprotector (CHEBI:176497) |
| dihydroergocristine mesylate (CHEBI:31490) has role vasodilator agent (CHEBI:35620) |
| dihydroergocristine mesylate (CHEBI:31490) has role α-adrenergic antagonist (CHEBI:37890) |
| dihydroergocristine mesylate (CHEBI:31490) is a methanesulfonate salt (CHEBI:38037) |
| Incoming Relation(s) |
| ergoloid mesylate (CHEBI:34706) has part dihydroergocristine mesylate (CHEBI:31490) |
| IUPAC Name |
|---|
| (10αH)-5'α-benzyl-12'-hydroxy-3',6',18-trioxo-2'-(propan-2-yl)-9,10-dihydroergotaman methanesulfonate |
| Synonyms | Source |
|---|---|
| 5'alpha-Benzyl-9,10alpha-dihydro-12'-hydroxy-2'-isopropylergotaman-3',6',18-trione monomethanesulphonate | KEGG COMPOUND |
| 9,10-dihydroergocristine mesilate | ChEBI |
| 9,10-dihydroergocristine mesylate | ChEBI |
| 9,10-dihydroergocristine methanesulfonate | ChemIDplus |
| dihydroergocristine mesilate | ChEBI |
| Dihydroergocristine mesylate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 392057 | ChemSpider |
| C13168 | KEGG COMPOUND |
| D07833 | KEGG DRUG |
| DBSALT002618 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3896115 | Beilstein |
| CAS:24730-10-7 | KEGG COMPOUND |
| CAS:24730-10-7 | ChemIDplus |
| Citations |
|---|