EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29NO |
| Net Charge | 0 |
| Average Mass | 287.447 |
| Monoisotopic Mass | 287.22491 |
| SMILES | O[C@@](CCN1CCCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H29NO/c21-19(18-11-5-6-12-18,17-9-3-1-4-10-17)13-16-20-14-7-2-8-15-20/h1,3-4,9-10,18,21H,2,5-8,11-16H2/t19-/m0/s1 |
| InChIKey | SWRUZBWLEWHWRI-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-cycrimine (CHEBI:59706) is a cycrimine (CHEBI:59692) |
| (R)-cycrimine (CHEBI:59706) is enantiomer of (S)-cycrimine (CHEBI:59707) |
| Incoming Relation(s) |
| (R)-cycrimine hydrochloride (CHEBI:59709) has part (R)-cycrimine (CHEBI:59706) |
| (S)-cycrimine (CHEBI:59707) is enantiomer of (R)-cycrimine (CHEBI:59706) |
| IUPAC Name |
|---|
| (1R)-1-cyclopentyl-1-phenyl-3-(piperidin-1-yl)propan-1-ol |
| Synonyms | Source |
|---|---|
| (1R)-cycrimine | ChEBI |
| (1R)-α-cyclopentyl-α-phenyl-1-piperidinepropanol | ChEBI |