EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29NO.HCl |
| Net Charge | 0 |
| Average Mass | 323.908 |
| Monoisotopic Mass | 323.20159 |
| SMILES | Cl.O[C@@](CCN1CCCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H29NO.ClH/c21-19(18-11-5-6-12-18,17-9-3-1-4-10-17)13-16-20-14-7-2-8-15-20;/h1,3-4,9-10,18,21H,2,5-8,11-16H2;1H/t19-;/m0./s1 |
| InChIKey | WBCWFMFZMRFRLT-FYZYNONXSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-cycrimine hydrochloride (CHEBI:59709) has part (R)-cycrimine (CHEBI:59706) |
| (R)-cycrimine hydrochloride (CHEBI:59709) is a cycrimine hydrochloride (CHEBI:59693) |
| (R)-cycrimine hydrochloride (CHEBI:59709) is a hydrochloride (CHEBI:36807) |
| (R)-cycrimine hydrochloride (CHEBI:59709) is enantiomer of (S)-cycrimine hydrochloride (CHEBI:59710) |
| Incoming Relation(s) |
| (S)-cycrimine hydrochloride (CHEBI:59710) is enantiomer of (R)-cycrimine hydrochloride (CHEBI:59709) |
| IUPAC Name |
|---|
| (1R)-1-cyclopentyl-1-phenyl-3-(piperidin-1-yl)propan-1-ol hydrochloride |
| Synonyms | Source |
|---|---|
| (1R)-α-cyclopentyl-α-phenyl-1-piperidinepropanol hydrochloride | ChEBI |
| (R)-cycrimine HCl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB00942 | DrugBank |