EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29NO |
| Net Charge | 0 |
| Average Mass | 287.447 |
| Monoisotopic Mass | 287.22491 |
| SMILES | O[C@](CCN1CCCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H29NO/c21-19(18-11-5-6-12-18,17-9-3-1-4-10-17)13-16-20-14-7-2-8-15-20/h1,3-4,9-10,18,21H,2,5-8,11-16H2/t19-/m1/s1 |
| InChIKey | SWRUZBWLEWHWRI-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-cycrimine (CHEBI:59707) is a cycrimine (CHEBI:59692) |
| (S)-cycrimine (CHEBI:59707) is enantiomer of (R)-cycrimine (CHEBI:59706) |
| Incoming Relation(s) |
| (S)-cycrimine hydrochloride (CHEBI:59710) has part (S)-cycrimine (CHEBI:59707) |
| (R)-cycrimine (CHEBI:59706) is enantiomer of (S)-cycrimine (CHEBI:59707) |
| IUPAC Name |
|---|
| (1S)-1-cyclopentyl-1-phenyl-3-(piperidin-1-yl)propan-1-ol |
| Synonyms | Source |
|---|---|
| (1S)-cycrimine | ChEBI |
| (1S)-α-cyclopentyl-α-phenyl-1-piperidinepropanol | ChEBI |