EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | O=C1OC(c2ccc(O)cc2)Cc2cccc(O)c21 |
| InChI | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
| InChIKey | DGKDFNDHPXVXHW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrangenol (CHEBI:5776) has functional parent 3,4-dihydroisocoumarin (CHEBI:23745) |
| hydrangenol (CHEBI:5776) has role anti-allergic agent (CHEBI:50857) |
| hydrangenol (CHEBI:5776) has role plant metabolite (CHEBI:76924) |
| hydrangenol (CHEBI:5776) is a dihydroisocoumarins (CHEBI:76546) |
| hydrangenol (CHEBI:5776) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 4'-O-β-D-glucopyranoside (CHEBI:68138) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has functional parent hydrangenol (CHEBI:5776) |
| IUPAC Name |
|---|
| 8-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-1H-isochromen-1-one |
| Synonym | Source |
|---|---|
| 8-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-1H-2-benzopyran-1-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00000217 | KNApSAcK |
| C10262 | KEGG COMPOUND |
| Hydrangenol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:241860 | Reaxys |
| CAS:480-47-7 | ChemIDplus |
| CAS:480-47-7 | KEGG COMPOUND |
| Citations |
|---|