EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O13 |
| Net Charge | 0 |
| Average Mass | 550.513 |
| Monoisotopic Mass | 550.16864 |
| SMILES | O=C1OC(c2ccc(O[C@@H]3O[C@H](CO[C@@H]4OC[C@](O)(CO)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)cc2)Cc2cccc(O)c21 |
| InChI | InChI=1S/C26H30O13/c27-10-26(34)11-36-25(22(26)32)35-9-17-19(29)20(30)21(31)24(39-17)37-14-6-4-12(5-7-14)16-8-13-2-1-3-15(28)18(13)23(33)38-16/h1-7,16-17,19-22,24-25,27-32,34H,8-11H2/t16?,17-,19-,20+,21-,22+,24-,25-,26-/m1/s1 |
| InChIKey | NCBLEDBCMRNNAV-NFZGRANLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) has role metabolite (CHEBI:25212) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) has role plant metabolite (CHEBI:76924) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) is a dihydroisocoumarins (CHEBI:76546) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) is a disaccharide derivative (CHEBI:63353) |
| hydrangenol 4'-O-β-D-apiofuranosyl-(1→6)-β-D-glucopyranoside (CHEBI:68134) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(8-hydroxy-1-oxo-3,4-dihydro-1H-isochromen-3-yl)phenyl 6-O-[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646964 | Reaxys |
| Citations |
|---|