EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O13 |
| Net Charge | 0 |
| Average Mass | 564.540 |
| Monoisotopic Mass | 564.18429 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](Oc3ccc([C@@H]4Cc5cccc(O)c5C(=O)O4)cc3)O[C@H](CO)[C@H]2O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O13/c1-11-19(30)21(32)22(33)26(36-11)40-24-20(31)17(10-28)39-27(23(24)34)37-14-7-5-12(6-8-14)16-9-13-3-2-4-15(29)18(13)25(35)38-16/h2-8,11,16-17,19-24,26-34H,9-10H2,1H3/t11-,16-,17+,19-,20+,21+,22+,23+,24-,26-,27+/m0/s1 |
| InChIKey | KAWWUODRABPWGU-YNZOJGRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) has functional parent hydrangenol (CHEBI:5776) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) has role metabolite (CHEBI:25212) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) has role plant metabolite (CHEBI:76924) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) is a dihydroisocoumarins (CHEBI:76546) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) is a disaccharide derivative (CHEBI:63353) |
| 3S-hydrangenol 4'-O-α-L-rhamnopyranoysl-(1→3)-β-D-glucopyranoside (CHEBI:68124) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[(3S)-8-hydroxy-1-oxo-3,4-dihydro-1H-isochromen-3-yl]phenyl 3-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646965 | Reaxys |
| Citations |
|---|