EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | O=C1OC(c2ccc(O)cc2)Cc2cccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C21H22O9/c22-9-15-17(24)18(25)19(26)21(30-15)29-13-3-1-2-11-8-14(28-20(27)16(11)13)10-4-6-12(23)7-5-10/h1-7,14-15,17-19,21-26H,8-9H2/t14?,15-,17-,18+,19-,21-/m1/s1 |
| InChIKey | IKTPWMTZNXOEIV-VRKGAULQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots, compound is the mixture of 3S and 3R isomers |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has role metabolite (CHEBI:25212) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has role plant metabolite (CHEBI:76924) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a dihydroisocoumarins (CHEBI:76546) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a monosaccharide derivative (CHEBI:63367) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a phenols (CHEBI:33853) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-1-oxo-3,4-dihydro-1H-isochromen-8-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100204 | Reaxys |
| Citations |
|---|