EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | O=C1OC(c2ccc(O)cc2)Cc2cccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C21H22O9/c22-9-15-17(24)18(25)19(26)21(30-15)29-13-3-1-2-11-8-14(28-20(27)16(11)13)10-4-6-12(23)7-5-10/h1-7,14-15,17-19,21-26H,8-9H2/t14?,15-,17-,18+,19-,21-/m1/s1 |
| InChIKey | IKTPWMTZNXOEIV-VRKGAULQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots, compound is the mixture of 3S and 3R isomers |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has functional parent hydrangenol (CHEBI:5776) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has role metabolite (CHEBI:25212) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) has role plant metabolite (CHEBI:76924) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a dihydroisocoumarins (CHEBI:76546) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a monosaccharide derivative (CHEBI:63367) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a phenols (CHEBI:33853) |
| hydrangenol 8-O-β-D-glucopyranoside (CHEBI:68133) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-1-oxo-3,4-dihydro-1H-isochromen-8-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100204 | Reaxys |
| Citations |
|---|