EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N5O7S2 |
| Net Charge | -1 |
| Average Mass | 454.466 |
| Monoisotopic Mass | 454.04966 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N5O7S2/c1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/p-1/b20-9-/t10-,14-/m1/s1 |
| InChIKey | GPRBEKHLDVQUJE-QSWIMTSFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotaxime(1−) (CHEBI:53670) is a cephalosporin carboxylic acid anion (CHEBI:52440) |
| cefotaxime(1−) (CHEBI:53670) is conjugate base of cefotaxime (CHEBI:204928) |
| Incoming Relation(s) |
| cefotaxime sodium (CHEBI:3498) has part cefotaxime(1−) (CHEBI:53670) |
| cefotaxime (CHEBI:204928) is conjugate acid of cefotaxime(1−) (CHEBI:53670) |
| IUPAC Name |
|---|
| 3-(acetoxymethyl)-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxylate |
| Synonym | Source |
|---|---|
| (6R,7R)-3-(acetoxymethyl)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1794119 | Gmelin |
| Reaxys:8174207 | Reaxys |