EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N5O7S2 |
| Net Charge | 0 |
| Average Mass | 455.474 |
| Monoisotopic Mass | 455.05694 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N5O7S2/c1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/b20-9-/t10-,14-/m1/s1 |
| InChIKey | GPRBEKHLDVQUJE-QSWIMTSFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotaxime (CHEBI:204928) has role antibacterial agent (CHEBI:33282) |
| cefotaxime (CHEBI:204928) has role antibacterial drug (CHEBI:36047) |
| cefotaxime (CHEBI:204928) has role drug allergen (CHEBI:88188) |
| cefotaxime (CHEBI:204928) is a 1,3-thiazoles (CHEBI:38418) |
| cefotaxime (CHEBI:204928) is a cephalosporin (CHEBI:23066) |
| cefotaxime (CHEBI:204928) is a oxime O-ether (CHEBI:36816) |
| cefotaxime (CHEBI:204928) is conjugate acid of cefotaxime(1−) (CHEBI:53670) |
| Incoming Relation(s) |
| cefotaxime(1−) (CHEBI:53670) is conjugate base of cefotaxime (CHEBI:204928) |
| IUPAC Name |
|---|
| 3-(acetoxymethyl)-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefotaxima | ChemIDplus |
| cefotaxime | KEGG DRUG |
| cefotaximum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-3-(acetoxymethyl)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| (6R,7R)-3-Acetoxymethyl-7-{2-(2-amino-thiazol-4-yl)-2-[(Z)-methoxyimino]-acetylamino}-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ChEMBL |
| (6R,7R,Z)-3-(acetoxymethyl)-7-(2-(2-aminothiazol-4-yl)-2-(methoxyimino)acetamido)-8-oxo-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ChEMBL |
| Cefotaxim hikma | ChEMBL |
| Cephotaxime | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1096643 | Reaxys |
| Beilstein:1096643 | Beilstein |
| CAS:63527-52-6 | DrugBank |
| CAS:63527-52-6 | KEGG COMPOUND |
| CAS:63527-52-6 | KEGG DRUG |
| CAS:63527-52-6 | ChemIDplus |
| Citations |
|---|