EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N5O7S2.Na |
| Net Charge | 0 |
| Average Mass | 477.456 |
| Monoisotopic Mass | 477.03888 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C16H17N5O7S2.Na/c1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8;/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26);/q;+1/p-1/b20-9-;/t10-,14-;/m1./s1 |
| InChIKey | AZZMGZXNTDTSME-JUZDKLSSSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefotaxime sodium (CHEBI:3498) has part cefotaxime(1−) (CHEBI:53670) |
| cefotaxime sodium (CHEBI:3498) has role antiinfective agent (CHEBI:35441) |
| cefotaxime sodium (CHEBI:3498) has role antimicrobial agent (CHEBI:33281) |
| cefotaxime sodium (CHEBI:3498) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3-(acetoxymethyl)-7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3,4-didehydrocepham-4-carboxylate |
| Synonyms | Source |
|---|---|
| Cefotaxime | ChemIDplus |
| (+)-Cefotaxime sodium salt | ChemIDplus |
| CTX | KEGG DRUG |
| HR 756 | ChEMBL |
| HR-756 | ChEMBL |
| NSC-756666 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cefcil | ChEMBL |
| Claforan | ChEMBL |
| Pretor | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1804247 | Gmelin |
| Beilstein:8181277 | Beilstein |
| CAS:64485-93-4 | ChemIDplus |
| CAS:64485-93-4 | KEGG COMPOUND |
| CAS:64485-93-4 | KEGG DRUG |
| Citations |
|---|