EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O4 |
| Net Charge | 0 |
| Average Mass | 402.575 |
| Monoisotopic Mass | 402.27701 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3(C)[C@@]([H])(CC=C4C(=O)OC[C@@]43[H])[C@]1(C)CC[C@@]1([H])[C@](C)(CO)CCC[C@]21C |
| InChI | InChI=1S/C25H38O4/c1-22(14-26)9-5-10-23(2)17(22)8-11-24(3)18-7-6-15-16(13-29-21(15)28)25(18,4)20(27)12-19(23)24/h6,16-20,26-27H,5,7-14H2,1-4H3/t16-,17-,18-,19+,20+,22-,23-,24-,25+/m0/s1 |
| InChIKey | LXWMXTKOJPFGPW-NFXGRNOLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) has role animal metabolite (CHEBI:75767) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) is a organic heteropentacyclic compound (CHEBI:38164) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) is a scalarane sesterterpenoid (CHEBI:59370) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (5aS,5bR,7aR,8R,11aR,11bR,13R,13aS,13bR)-13-hydroxy-8-(hydroxymethyl)-5b,8,11a,13a-tetramethyl-5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a,13b-hexadecahydrochryseno[1,2-c]furan-3(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15815956 | Reaxys |
| Citations |
|---|