EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O3 |
| Net Charge | 0 |
| Average Mass | 402.619 |
| Monoisotopic Mass | 402.31340 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3(C)[C@@]([H])(CC=C4CO[C@@H](OC)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C26H42O3/c1-23(2)11-7-12-24(3)17(23)10-13-25(4)18-9-8-16-15-29-22(28-6)21(16)26(18,5)20(27)14-19(24)25/h8,17-22,27H,7,9-15H2,1-6H3/t17-,18-,19+,20+,21+,22+,24-,25-,26+/m0/s1 |
| InChIKey | BIJAKZXAJWXIHK-GLJICWRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-O-deacetyl-19-O-methyl-12-epi-deoxoscalarin (CHEBI:68040) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-O-deacetyl-19-O-methyl-12-epi-deoxoscalarin (CHEBI:68040) has role animal metabolite (CHEBI:75767) |
| 12-O-deacetyl-19-O-methyl-12-epi-deoxoscalarin (CHEBI:68040) is a organic heteropentacyclic compound (CHEBI:38164) |
| 12-O-deacetyl-19-O-methyl-12-epi-deoxoscalarin (CHEBI:68040) is a scalarane sesterterpenoid (CHEBI:59370) |
| IUPAC Name |
|---|
| (1R,5aS,5bR,7aS,11aS,11bR,13R,13aS,13bS)-1-methoxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a,13b-octadecahydrochryseno[1,2-c]furan-13-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10609265 | Reaxys |
| Citations |
|---|