EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)C(=O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])CC(C)(C)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-20-21(31)9-10-22-27(20,5)12-11-23-28(22,6)16-18-30(8)24-19-25(2,3)13-14-26(24,4)15-17-29(23,30)7/h20,22-24H,9-19H2,1-8H3/t20-,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | OFMXGFHWLZPCFL-SVRPQWSVSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. anti-inflammatory drug A substance that reduces or suppresses inflammation. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| friedelin (CHEBI:5171) has role anti-inflammatory drug (CHEBI:35472) |
| friedelin (CHEBI:5171) has role antipyretic (CHEBI:35493) |
| friedelin (CHEBI:5171) has role non-narcotic analgesic (CHEBI:35481) |
| friedelin (CHEBI:5171) has role plant metabolite (CHEBI:76924) |
| friedelin (CHEBI:5171) is a cyclic terpene ketone (CHEBI:36130) |
| friedelin (CHEBI:5171) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 1β-hydroxyfriedelin (CHEBI:70415) has functional parent friedelin (CHEBI:5171) |
| 3β-hydroxyfriedelan-23-oic acid (CHEBI:70416) has functional parent friedelin (CHEBI:5171) |
| acetyl aleuritolic acid (CHEBI:70418) has functional parent friedelin (CHEBI:5171) |
| friedelin-3,4-lactone (CHEBI:70417) has functional parent friedelin (CHEBI:5171) |
| maytenfolone A (CHEBI:66686) has functional parent friedelin (CHEBI:5171) |
| IUPAC Name |
|---|
| (4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydropicen-3(2H)-one |
| Synonyms | Source |
|---|---|
| D:A-friedooleanan-3-one | ChemIDplus |
| friedelan-3-one | ChemIDplus |
| (−)-friedelin | ChEBI |
| friedeline | ChemIDplus |
| UniProt Name | Source |
|---|---|
| friedelin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003747 | KNApSAcK |
| C08626 | KEGG COMPOUND |
| CPD-13047 | MetaCyc |
| WO2009072916 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:559-74-0 | ChemIDplus |
| CAS:559-74-0 | KEGG COMPOUND |
| Citations |
|---|