EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@@]12CC(C)(C)CC[C@]1(C)CC[C@]1(C)[C@@]3([H])CC[C@]4(C)[C@@H](C)C(=O)C[C@@H](O)[C@@]4([H])[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C30H50O2/c1-19-20(31)17-21(32)24-27(19,5)10-9-22-28(24,6)14-16-30(8)23-18-25(2,3)11-12-26(23,4)13-15-29(22,30)7/h19,21-24,32H,9-18H2,1-8H3/t19-,21+,22-,23+,24+,26+,27+,28+,29+,30-/m0/s1 |
| InChIKey | BFXGCIAJMLLIBE-NYCLATEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcia parviflora (IPNI:107401-2) | |||
| leaf (BTO:0000713) | PubMed (20958014) | EtOAc extract of air-dried, powdered branch and leaves | |
| branch (BTO:0000148) | PubMed (20958014) | EtOAc extract of air-dried, powdered branch and leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β-hydroxyfriedelin (CHEBI:70415) has functional parent friedelin (CHEBI:5171) |
| 1β-hydroxyfriedelin (CHEBI:70415) has role plant metabolite (CHEBI:76924) |
| 1β-hydroxyfriedelin (CHEBI:70415) is a cyclic terpene ketone (CHEBI:36130) |
| 1β-hydroxyfriedelin (CHEBI:70415) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (1R,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aR,14bS)-1-hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydropicen-3(2H)-one |
| Synonym | Source |
|---|---|
| 1β-hydroxy-3-oxo-D:A-friedooleanane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20006447 | Reaxys |
| Citations |
|---|