EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)C(=O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@]4(C)CC[C@]3(COC4=O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-18-19(31)7-8-20-26(18,3)10-9-21-27(20,4)12-13-28(5)22-15-25(2)11-14-30(22,17-34-24(25)33)23(32)16-29(21,28)6/h18,20-23,32H,7-17H2,1-6H3/t18-,20+,21-,22-,23+,25-,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | BVZOXPCXYRGXKC-RUXXHOCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus hindsii (ncbitaxon:489979) | stem (BTO:0001300) | PubMed (9115698) |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maytenfolone A (CHEBI:66686) has functional parent friedelin (CHEBI:5171) |
| maytenfolone A (CHEBI:66686) has role anti-HIV agent (CHEBI:64946) |
| maytenfolone A (CHEBI:66686) has role antineoplastic agent (CHEBI:35610) |
| maytenfolone A (CHEBI:66686) has role metabolite (CHEBI:25212) |
| maytenfolone A (CHEBI:66686) is a bridged compound (CHEBI:35990) |
| maytenfolone A (CHEBI:66686) is a cyclic terpene ketone (CHEBI:36130) |
| maytenfolone A (CHEBI:66686) is a hexacyclic triterpenoid (CHEBI:70994) |
| maytenfolone A (CHEBI:66686) is a secondary alcohol (CHEBI:35681) |
| maytenfolone A (CHEBI:66686) is a terpene lactone (CHEBI:37668) |
| IUPAC Name |
|---|
| (2S,5aS,6R,7aR,7bS,9aS,10R,13aS,13bS,15aS,15bS)-6-hydroxy-2,7a,9a,10,13b,15a-hexamethyloctadecahydro-2,5a-ethanochryseno[2,1-c]oxepine-3,11(5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7666520 | Reaxys |
| Citations |
|---|