EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)C(=O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@]4(C)CC[C@]3(COC4=O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H46O4/c1-18-19(31)7-8-20-26(18,3)10-9-21-27(20,4)12-13-28(5)22-15-25(2)11-14-30(22,17-34-24(25)33)23(32)16-29(21,28)6/h18,20-23,32H,7-17H2,1-6H3/t18-,20+,21-,22-,23+,25-,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | BVZOXPCXYRGXKC-RUXXHOCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Celastrus hindsii (ncbitaxon:489979) | stem (BTO:0001300) | PubMed (9115698) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maytenfolone A (CHEBI:66686) has functional parent friedelin (CHEBI:5171) |
| maytenfolone A (CHEBI:66686) has role anti-HIV agent (CHEBI:64946) |
| maytenfolone A (CHEBI:66686) has role antineoplastic agent (CHEBI:35610) |
| maytenfolone A (CHEBI:66686) has role metabolite (CHEBI:25212) |
| maytenfolone A (CHEBI:66686) is a bridged compound (CHEBI:35990) |
| maytenfolone A (CHEBI:66686) is a cyclic terpene ketone (CHEBI:36130) |
| maytenfolone A (CHEBI:66686) is a hexacyclic triterpenoid (CHEBI:70994) |
| maytenfolone A (CHEBI:66686) is a secondary alcohol (CHEBI:35681) |
| maytenfolone A (CHEBI:66686) is a terpene lactone (CHEBI:37668) |
| IUPAC Name |
|---|
| (2S,5aS,6R,7aR,7bS,9aS,10R,13aS,13bS,15aS,15bS)-6-hydroxy-2,7a,9a,10,13b,15a-hexamethyloctadecahydro-2,5a-ethanochryseno[2,1-c]oxepine-3,11(5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7666520 | Reaxys |
| Citations |
|---|