EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O3 |
| Net Charge | 0 |
| Average Mass | 472.754 |
| Monoisotopic Mass | 472.39165 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](CC(=O)O)[C@@H](O)CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])CC(C)(C)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C31H52O3/c1-26(2)12-13-27(3)14-16-30(6)23-10-11-28(4)20(18-25(33)34)21(32)8-9-22(28)29(23,5)15-17-31(30,7)24(27)19-26/h20-24,32H,8-19H2,1-7H3,(H,33,34)/t20-,21-,22+,23-,24+,27+,28+,29-,30+,31-/m0/s1 |
| InChIKey | MCQITBJTZHPOCF-NOHCWTEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcia parviflora (IPNI:107401-2) | |||
| leaf (BTO:0000713) | PubMed (20958014) | EtOAc extract of air-dried, powdered branch and leaves | |
| branch (BTO:0000148) | PubMed (20958014) | EtOAc extract of air-dried, powdered branch and leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxyfriedelan-23-oic acid (CHEBI:70416) has functional parent friedelin (CHEBI:5171) |
| 3β-hydroxyfriedelan-23-oic acid (CHEBI:70416) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3β-hydroxyfriedelan-23-oic acid (CHEBI:70416) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| [(3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-3-hydroxy-4a,6b,8a,11,11,12b,14a-heptamethyldocosahydropicen-4-yl]acetic acid |
| Citations |
|---|